C22H18N4O2S2 — CID 55494367
(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 55494367) has the molecular formula C22H18N4O2S2 and a molecular weight of 434.55 g/mol. Its IUPAC name is (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55494367 |
| Molecular Formula | C22H18N4O2S2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1nc(COc2ccc(/C=C/C(=O)Nc3nnc(-c4ccccc4)s3)cc2)cs1 |
| InChI | InChI=1S/C22H18N4O2S2/c1-15-23-18(14-29-15)13-28-19-10-7-16(8-11-19)9-12-20(27)24-22-26-25-21(30-22)17-5-3-2-4-6-17/h2-12,14H,13H2,1H3,(H,24,26,27)/b12-9+ |
| InChIKey | ARARBTNIGLTFAA-FMIVXFBMSA-N |
| XLogP | 5.20 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|