C19H16BrN3O3S2 — CID 26074368
5-bromo-N'-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]thiophene-2-carbohydrazide (PubChem CID 26074368) has the molecular formula C19H16BrN3O3S2 and a molecular weight of 478.39 g/mol. Its IUPAC name is 5-bromo-N'-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 26074368 |
| Molecular Formula | C19H16BrN3O3S2 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | 5-bromo-N'-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]thiophene-2-carbohydrazide |
| SMILES | Cc1nc(COc2ccc(/C=C/C(=O)NNC(=O)c3ccc(Br)s3)cc2)cs1 |
| InChI | InChI=1S/C19H16BrN3O3S2/c1-12-21-14(11-27-12)10-26-15-5-2-13(3-6-15)4-9-18(24)22-23-19(25)16-7-8-17(20)28-16/h2-9,11H,10H2,1H3,(H,22,24)(H,23,25)/b9-4+ |
| InChIKey | JBXJPXICFDRZOH-RUDMXATFSA-N |
| XLogP | 4.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|