C23H22N4O3S — CID 55778678
3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 55778678) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | 3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55778678 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccc(C=CC(=O)Nc3cccc(N4CCNC4=O)c3)cc2)cs1 |
| InChI | InChI=1S/C23H22N4O3S/c1-16-25-19(15-31-16)14-30-21-8-5-17(6-9-21)7-10-22(28)26-18-3-2-4-20(13-18)27-12-11-24-23(27)29/h2-10,13,15H,11-12,14H2,1H3,(H,24,29)(H,26,28) |
| InChIKey | UBIWIHIHGNJCBM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|