C26H25N5O3S — CID 55979369
3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide (PubChem CID 55979369) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is 3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide.
| Compound Name | 3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55979369 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccc(C=CC(=O)NCc3cccc(NC(=O)Cn4cccn4)c3)cc2)cs1 |
| InChI | InChI=1S/C26H25N5O3S/c1-19-29-23(18-35-19)17-34-24-9-6-20(7-10-24)8-11-25(32)27-15-21-4-2-5-22(14-21)30-26(33)16-31-13-3-12-28-31/h2-14,18H,15-17H2,1H3,(H,27,32)(H,30,33) |
| InChIKey | ZUQMDTAXMVVTDZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|