C25H25N5O3 — CID 55978347
N-cyclopropyl-4-[(E)-3-oxo-3-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methylamino]prop-1-enyl]benzamide (PubChem CID 55978347) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-oxo-3-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methylamino]prop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-oxo-3-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methylamino]prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55978347 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-oxo-3-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methylamino]prop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NC2CC2)cc1)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C25H25N5O3/c31-23(12-7-18-5-8-20(9-6-18)25(33)29-21-10-11-21)26-16-19-3-1-4-22(15-19)28-24(32)17-30-14-2-13-27-30/h1-9,12-15,21H,10-11,16-17H2,(H,26,31)(H,28,32)(H,29,33)/b12-7+ |
| InChIKey | WKQHWACLKPQEKI-KPKJPENVSA-N |
| XLogP | 2.74 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|