C28H28N2O3 — CID 55697987
N-cyclopropyl-4-[(E)-3-oxo-3-[[4-(phenylmethoxymethyl)phenyl]methylamino]prop-1-enyl]benzamide (PubChem CID 55697987) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-oxo-3-[[4-(phenylmethoxymethyl)phenyl]methylamino]prop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-oxo-3-[[4-(phenylmethoxymethyl)phenyl]methylamino]prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55697987 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-oxo-3-[[4-(phenylmethoxymethyl)phenyl]methylamino]prop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NC2CC2)cc1)NCc1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O3/c31-27(17-12-21-10-13-25(14-11-21)28(32)30-26-15-16-26)29-18-22-6-8-24(9-7-22)20-33-19-23-4-2-1-3-5-23/h1-14,17,26H,15-16,18-20H2,(H,29,31)(H,30,32)/b17-12+ |
| InChIKey | XLNKLTVSBSNHIT-SFQUDFHCSA-N |
| XLogP | 4.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|