C22H24N2O3 — CID 55907831
N-cyclopropyl-4-[3-[2-(2-methylphenoxy)ethylamino]-3-oxoprop-1-enyl]benzamide (PubChem CID 55907831) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[3-[2-(2-methylphenoxy)ethylamino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[3-[2-(2-methylphenoxy)ethylamino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55907831 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-cyclopropyl-4-[3-[2-(2-methylphenoxy)ethylamino]-3-oxoprop-1-enyl]benzamide |
| SMILES | Cc1ccccc1OCCNC(=O)C=Cc1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-4-2-3-5-20(16)27-15-14-23-21(25)13-8-17-6-9-18(10-7-17)22(26)24-19-11-12-19/h2-10,13,19H,11-12,14-15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | IXVJFGSTIROAFV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|