C27H26N4O2 — CID 52719151
3,3-diphenyl-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]propanamide (PubChem CID 52719151) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3,3-diphenyl-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]propanamide.
| Compound Name | 3,3-diphenyl-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 52719151 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3,3-diphenyl-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]propanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C27H26N4O2/c32-26(18-25(22-10-3-1-4-11-22)23-12-5-2-6-13-23)28-19-21-9-7-14-24(17-21)30-27(33)20-31-16-8-15-29-31/h1-17,25H,18-20H2,(H,28,32)(H,30,33) |
| InChIKey | PPBXGNKAHZLDNM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |