C17H23N5O3 — CID 87037168
N-[3-[[[ethyl(2-hydroxyethyl)carbamoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 87037168) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[3-[[[ethyl(2-hydroxyethyl)carbamoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[ethyl(2-hydroxyethyl)carbamoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 87037168 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[3-[[[ethyl(2-hydroxyethyl)carbamoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | CCN(CCO)C(=O)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C17H23N5O3/c1-2-21(9-10-23)17(25)18-12-14-5-3-6-15(11-14)20-16(24)13-22-8-4-7-19-22/h3-8,11,23H,2,9-10,12-13H2,1H3,(H,18,25)(H,20,24) |
| InChIKey | QAGDCZCRADEOGG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |