C20H19N5O4 — CID 55953520
2-methyl-3-nitro-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide (PubChem CID 55953520) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide.
| Compound Name | 2-methyl-3-nitro-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55953520 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-methyl-3-nitro-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide |
| SMILES | Cc1c(C(=O)NCc2cccc(NC(=O)Cn3cccn3)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N5O4/c1-14-17(7-3-8-18(14)25(28)29)20(27)21-12-15-5-2-6-16(11-15)23-19(26)13-24-10-4-9-22-24/h2-11H,12-13H2,1H3,(H,21,27)(H,23,26) |
| InChIKey | DPQLFHYQZJBSNC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|