C22H20N8O4 — CID 55953271
5-methyl-1-(3-nitrophenyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]triazole-4-carboxamide (PubChem CID 55953271) has the molecular formula C22H20N8O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is 5-methyl-1-(3-nitrophenyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-(3-nitrophenyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 55953271 |
| Molecular Formula | C22H20N8O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 5-methyl-1-(3-nitrophenyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cccc(NC(=O)Cn3cccn3)c2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N8O4/c1-15-21(26-27-29(15)18-7-3-8-19(12-18)30(33)34)22(32)23-13-16-5-2-6-17(11-16)25-20(31)14-28-10-4-9-24-28/h2-12H,13-14H2,1H3,(H,23,32)(H,25,31) |
| InChIKey | CYPRESUBZWHZAE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|