C26H21N5O2 — CID 55953532
N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzo[f]quinoline-5-carboxamide (PubChem CID 55953532) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzo[f]quinoline-5-carboxamide.
| Compound Name | N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzo[f]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 55953532 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzo[f]quinoline-5-carboxamide |
| SMILES | O=C(Cn1cccn1)Nc1cccc(CNC(=O)c2cc3ccccc3c3cccnc23)c1 |
| InChI | InChI=1S/C26H21N5O2/c32-24(17-31-13-5-12-29-31)30-20-8-3-6-18(14-20)16-28-26(33)23-15-19-7-1-2-9-21(19)22-10-4-11-27-25(22)23/h1-15H,16-17H2,(H,28,33)(H,30,32) |
| InChIKey | XIJJKNDUGMDTED-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|