C28H23N5O4 — CID 55954551
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide (PubChem CID 55954551) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55954551 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(Cn1cccn1)Nc1cccc(CNC(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C28H23N5O4/c34-25(18-32-14-4-13-30-32)31-22-6-3-5-20(15-22)16-29-26(35)21-11-9-19(10-12-21)17-33-27(36)23-7-1-2-8-24(23)28(33)37/h1-15H,16-18H2,(H,29,35)(H,31,34) |
| InChIKey | UETLXZHZVAXYNQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|