C22H23N5O4S — CID 55953779
3-(cyclopropylsulfamoyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide (PubChem CID 55953779) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55953779 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(Cn1cccn1)Nc1cccc(CNC(=O)c2cccc(S(=O)(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C22H23N5O4S/c28-21(15-27-11-3-10-24-27)25-19-6-1-4-16(12-19)14-23-22(29)17-5-2-7-20(13-17)32(30,31)26-18-8-9-18/h1-7,10-13,18,26H,8-9,14-15H2,(H,23,29)(H,25,28) |
| InChIKey | URLVVPMZQOBIEK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |