C26H26FN3O4S — CID 55894287
3-(cyclopentylsulfamoyl)-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide (PubChem CID 55894287) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55894287 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(NC(=O)c2ccc(F)cc2)c1)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C26H26FN3O4S/c27-21-13-11-19(12-14-21)26(32)29-23-9-3-5-18(15-23)17-28-25(31)20-6-4-10-24(16-20)35(33,34)30-22-7-1-2-8-22/h3-6,9-16,22,30H,1-2,7-8,17H2,(H,28,31)(H,29,32) |
| InChIKey | MANNNGAJWLFAPQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |