C22H25FN2O2 — CID 55893896
N-[3-[[(2-cyclohexylacetyl)amino]methyl]phenyl]-4-fluorobenzamide (PubChem CID 55893896) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is N-[3-[[(2-cyclohexylacetyl)amino]methyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[[(2-cyclohexylacetyl)amino]methyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55893896 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[3-[[(2-cyclohexylacetyl)amino]methyl]phenyl]-4-fluorobenzamide |
| SMILES | O=C(CC1CCCCC1)NCc1cccc(NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H25FN2O2/c23-19-11-9-18(10-12-19)22(27)25-20-8-4-7-17(13-20)15-24-21(26)14-16-5-2-1-3-6-16/h4,7-13,16H,1-3,5-6,14-15H2,(H,24,26)(H,25,27) |
| InChIKey | VOXUSJNOPMRFQY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |