C20H23N3O2 — CID 108926494
N-[3-[[(2-cyclopentylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108926494) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[3-[[(2-cyclopentylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[(2-cyclopentylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108926494 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[3-[[(2-cyclopentylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(CC1CCCC1)NCc1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C20H23N3O2/c24-19(12-15-5-1-2-6-15)22-13-16-7-3-9-18(11-16)23-20(25)17-8-4-10-21-14-17/h3-4,7-11,14-15H,1-2,5-6,12-13H2,(H,22,24)(H,23,25) |
| InChIKey | FSOVSAZZGKOGCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |