C19H17N3O2S — CID 108926355
N-[3-[[(2-thiophen-2-ylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108926355) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[3-[[(2-thiophen-2-ylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[(2-thiophen-2-ylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108926355 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[3-[[(2-thiophen-2-ylacetyl)amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Cc1cccs1)NCc1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C19H17N3O2S/c23-18(11-17-7-3-9-25-17)21-12-14-4-1-6-16(10-14)22-19(24)15-5-2-8-20-13-15/h1-10,13H,11-12H2,(H,21,23)(H,22,24) |
| InChIKey | FSTDDPKCDYGPSK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |