C23H19BrFN3O3 — CID 55948110
3-bromo-N-[2-[[3-[(4-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]benzamide (PubChem CID 55948110) has the molecular formula C23H19BrFN3O3 and a molecular weight of 484.33 g/mol. Its IUPAC name is 3-bromo-N-[2-[[3-[(4-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[[3-[(4-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55948110 |
| Molecular Formula | C23H19BrFN3O3 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 3-bromo-N-[2-[[3-[(4-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NCc1cccc(NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H19BrFN3O3/c24-18-5-2-4-17(12-18)22(30)27-14-21(29)26-13-15-3-1-6-20(11-15)28-23(31)16-7-9-19(25)10-8-16/h1-12H,13-14H2,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | VIYMVEFECBMSQQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |