C20H21N2O5S- — CID 6981857
4-[[3-(cyclohexylsulfamoyl)benzoyl]amino]benzoate (PubChem CID 6981857) has the molecular formula C20H21N2O5S- and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-[[3-(cyclohexylsulfamoyl)benzoyl]amino]benzoate.
| Compound Name | 4-[[3-(cyclohexylsulfamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6981857 |
| Molecular Formula | C20H21N2O5S- |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-[[3-(cyclohexylsulfamoyl)benzoyl]amino]benzoate |
| SMILES | O=C([O-])c1ccc(NC(=O)c2cccc(S(=O)(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c23-19(21-16-11-9-14(10-12-16)20(24)25)15-5-4-8-18(13-15)28(26,27)22-17-6-2-1-3-7-17/h4-5,8-13,17,22H,1-3,6-7H2,(H,21,23)(H,24,25)/p-1 |
| InChIKey | NFQXIUJHORYDOH-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |