C13H16NNaO4S — CID 122705986
sodium 4-(cyclohexylsulfamoyl)benzoate (PubChem CID 122705986) has the molecular formula C13H16NNaO4S and a molecular weight of 305.33 g/mol. Its IUPAC name is sodium 4-(cyclohexylsulfamoyl)benzoate.
| Compound Name | sodium 4-(cyclohexylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 122705986 |
| Molecular Formula | C13H16NNaO4S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | sodium 4-(cyclohexylsulfamoyl)benzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)NC2CCCCC2)cc1.[Na+] |
| InChI | InChI=1S/C13H17NO4S.Na/c15-13(16)10-6-8-12(9-7-10)19(17,18)14-11-4-2-1-3-5-11;/h6-9,11,14H,1-5H2,(H,15,16);/q;+1/p-1 |
| InChIKey | MLHFBDVMTRIQMW-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |