C14H22N2O4S2 — CID 859646
1-N-cyclohexyl-4-N,4-N-dimethylbenzene-1,4-disulfonamide (PubChem CID 859646) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-N,4-N-dimethylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-cyclohexyl-4-N,4-N-dimethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 859646 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-N-cyclohexyl-4-N,4-N-dimethylbenzene-1,4-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-16(2)22(19,20)14-10-8-13(9-11-14)21(17,18)15-12-6-4-3-5-7-12/h8-12,15H,3-7H2,1-2H3 |
| InChIKey | SFYCSARQYJUMQI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |