C20H14IN2O5S- — CID 6968790
4-[[3-[(4-iodophenyl)sulfamoyl]benzoyl]amino]benzoate (PubChem CID 6968790) has the molecular formula C20H14IN2O5S- and a molecular weight of 521.31 g/mol. Its IUPAC name is 4-[[3-[(4-iodophenyl)sulfamoyl]benzoyl]amino]benzoate.
| Compound Name | 4-[[3-[(4-iodophenyl)sulfamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6968790 |
| Molecular Formula | C20H14IN2O5S- |
| Molecular Weight | 521.31 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | 4-[[3-[(4-iodophenyl)sulfamoyl]benzoyl]amino]benzoate |
| SMILES | O=C([O-])c1ccc(NC(=O)c2cccc(S(=O)(=O)Nc3ccc(I)cc3)c2)cc1 |
| InChI | InChI=1S/C20H15IN2O5S/c21-15-6-10-17(11-7-15)23-29(27,28)18-3-1-2-14(12-18)19(24)22-16-8-4-13(5-9-16)20(25)26/h1-12,23H,(H,22,24)(H,25,26)/p-1 |
| InChIKey | KBUBXIAILBXPJG-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|