C19H21N3O4S — CID 39821970
N-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylsulfamoyl)benzamide (PubChem CID 39821970) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 39821970 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylsulfamoyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(S(=O)(=O)NC2CC2)c1)NCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O4S/c23-18(20-12-14-5-2-1-3-6-14)13-21-19(24)15-7-4-8-17(11-15)27(25,26)22-16-9-10-16/h1-8,11,16,22H,9-10,12-13H2,(H,20,23)(H,21,24) |
| InChIKey | CPBBWQRMJLTTTA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |