C14H20N2O4S — CID 78854342
3-(cyclopentylsulfamoyl)-N-(2-hydroxyethyl)benzamide (PubChem CID 78854342) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 78854342 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C14H20N2O4S/c17-9-8-15-14(18)11-4-3-7-13(10-11)21(19,20)16-12-5-1-2-6-12/h3-4,7,10,12,16-17H,1-2,5-6,8-9H2,(H,15,18) |
| InChIKey | XMBVOEBSDJJICG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |