C17H24N2O5S — CID 119249979
3-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 119249979) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 119249979 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNC(=O)c1cccc(S(=O)(=O)NC2CCCC2)c1)C(=O)O |
| InChI | InChI=1S/C17H24N2O5S/c1-17(2,16(21)22)11-18-15(20)12-6-5-9-14(10-12)25(23,24)19-13-7-3-4-8-13/h5-6,9-10,13,19H,3-4,7-8,11H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | CNQNZBGMJUZYAB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |