C20H31N3O4S — CID 43057311
3-(cyclopentylsulfamoyl)-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]benzamide (PubChem CID 43057311) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 43057311 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]benzamide |
| SMILES | CC1CN(CCNC(=O)c2cccc(S(=O)(=O)NC3CCCC3)c2)CC(C)O1 |
| InChI | InChI=1S/C20H31N3O4S/c1-15-13-23(14-16(2)27-15)11-10-21-20(24)17-6-5-9-19(12-17)28(25,26)22-18-7-3-4-8-18/h5-6,9,12,15-16,18,22H,3-4,7-8,10-11,13-14H2,1-2H3,(H,21,24) |
| InChIKey | OKLQBIAGTZVTJJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |