C23H37N3O4S — CID 55629229
N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 55629229) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55629229 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)NCCCN3CC(C)OC(C)C3)c2)C1 |
| InChI | InChI=1S/C23H37N3O4S/c1-17-11-18(2)14-26(13-17)31(28,29)22-8-5-7-21(12-22)23(27)24-9-6-10-25-15-19(3)30-20(4)16-25/h5,7-8,12,17-20H,6,9-11,13-16H2,1-4H3,(H,24,27) |
| InChIKey | FOIXQUXORXHPJY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|