C21H33N3O3S — CID 94141666
N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 94141666) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 94141666 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | C[C@H]1C[C@H](C)CN(CCCNC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)C1 |
| InChI | InChI=1S/C21H33N3O3S/c1-17-13-18(2)16-23(15-17)10-6-9-22-21(25)19-7-5-8-20(14-19)28(26,27)24-11-3-4-12-24/h5,7-8,14,17-18H,3-4,6,9-13,15-16H2,1-2H3,(H,22,25)/t17-,18-/m0/s1 |
| InChIKey | ZDMUIVGFRUUFQG-ROUUACIJSA-N |
| XLogP | 2.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|