C21H34N3O3S+ — CID 9472505
N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 9472505) has the molecular formula C21H34N3O3S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9472505 |
| Molecular Formula | C21H34N3O3S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | C[C@@H]1CCCC[NH+]1CCCNC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H33N3O3S/c1-18-9-3-6-13-23(18)14-8-12-22-21(25)19-10-7-11-20(17-19)28(26,27)24-15-4-2-5-16-24/h7,10-11,17-18H,2-6,8-9,12-16H2,1H3,(H,22,25)/p+1/t18-/m1/s1 |
| InChIKey | ORZCXKAIVTWMKC-GOSISDBHSA-O |
| XLogP | 1.44 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|