C22H36N3O3S+ — CID 9051584
4-(azepan-1-ylsulfonyl)-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]benzamide (PubChem CID 9051584) has the molecular formula C22H36N3O3S+ and a molecular weight of 422.62 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 9051584 |
| Molecular Formula | C22H36N3O3S+ |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]benzamide |
| SMILES | CC1CC[NH+](CCCNC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H35N3O3S/c1-19-11-17-24(18-12-19)14-6-13-23-22(26)20-7-9-21(10-8-20)29(27,28)25-15-4-2-3-5-16-25/h7-10,19H,2-6,11-18H2,1H3,(H,23,26)/p+1 |
| InChIKey | HJRCSDIHNMSFOA-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|