C16H26N3O3S+ — CID 4992823
dimethyl-[2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]ethyl]azanium (PubChem CID 4992823) has the molecular formula C16H26N3O3S+ and a molecular weight of 340.47 g/mol. Its IUPAC name is dimethyl-[2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 4992823 |
| Molecular Formula | C16H26N3O3S+ |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | dimethyl-[2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]ethyl]azanium |
| SMILES | C[NH+](C)CCNC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-18(2)13-10-17-16(20)14-6-8-15(9-7-14)23(21,22)19-11-4-3-5-12-19/h6-9H,3-5,10-13H2,1-2H3,(H,17,20)/p+1 |
| InChIKey | JQACMYKSAAVGQI-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |