C18H29N2O3S+ — CID 9473052
N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 9473052) has the molecular formula C18H29N2O3S+ and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 9473052 |
| Molecular Formula | C18H29N2O3S+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H28N2O3S/c1-15-6-3-4-12-20(15)13-5-11-19-18(21)17-9-7-16(8-10-17)14-24(2,22)23/h7-10,15H,3-6,11-14H2,1-2H3,(H,19,21)/p+1/t15-/m0/s1 |
| InChIKey | AJDYJEHZQSAPJT-HNNXBMFYSA-O |
| XLogP | 0.81 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|