C18H27ClN3O2+ — CID 9472854
4-chloro-N-[2-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide (PubChem CID 9472854) has the molecular formula C18H27ClN3O2+ and a molecular weight of 352.89 g/mol. Its IUPAC name is 4-chloro-N-[2-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9472854 |
| Molecular Formula | C18H27ClN3O2+ |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-chloro-N-[2-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide |
| SMILES | C[C@@H]1CCCC[NH+]1CCCNC(=O)CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClN3O2/c1-14-5-2-3-11-22(14)12-4-10-20-17(23)13-21-18(24)15-6-8-16(19)9-7-15/h6-9,14H,2-5,10-13H2,1H3,(H,20,23)(H,21,24)/p+1/t14-/m1/s1 |
| InChIKey | OTOCLAOSACZWOX-CQSZACIVSA-O |
| XLogP | 1.03 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|