C18H27N4O3S+ — CID 9473155
2-[(2-cyanophenyl)sulfonylamino]-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide (PubChem CID 9473155) has the molecular formula C18H27N4O3S+ and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-[(2-cyanophenyl)sulfonylamino]-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide.
| Compound Name | 2-[(2-cyanophenyl)sulfonylamino]-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 9473155 |
| Molecular Formula | C18H27N4O3S+ |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[(2-cyanophenyl)sulfonylamino]-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide |
| SMILES | C[C@@H]1CCCC[NH+]1CCCNC(=O)CNS(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C18H26N4O3S/c1-15-7-4-5-11-22(15)12-6-10-20-18(23)14-21-26(24,25)17-9-3-2-8-16(17)13-19/h2-3,8-9,15,21H,4-7,10-12,14H2,1H3,(H,20,23)/p+1/t15-/m1/s1 |
| InChIKey | YEJSYKOGOVNRFX-OAHLLOKOSA-O |
| XLogP | -0.20 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|