C17H16ClN3O3S2 — CID 9259068
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(2-cyanophenyl)sulfonylamino]acetamide (PubChem CID 9259068) has the molecular formula C17H16ClN3O3S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(2-cyanophenyl)sulfonylamino]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(2-cyanophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 9259068 |
| Molecular Formula | C17H16ClN3O3S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[(2-cyanophenyl)sulfonylamino]acetamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NCC(=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O3S2/c18-14-5-7-15(8-6-14)25-10-9-20-17(22)12-21-26(23,24)16-4-2-1-3-13(16)11-19/h1-8,21H,9-10,12H2,(H,20,22) |
| InChIKey | YEXZVXOZAFQDKY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|