C20H18ClNOS2 — CID 7630379
N-[2-(4-chlorophenyl)sulfanylethyl]-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 7630379) has the molecular formula C20H18ClNOS2 and a molecular weight of 387.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 7630379 |
| Molecular Formula | C20H18ClNOS2 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccc2ccccc2c1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNOS2/c21-17-6-9-18(10-7-17)24-12-11-22-20(23)14-25-19-8-5-15-3-1-2-4-16(15)13-19/h1-10,13H,11-12,14H2,(H,22,23) |
| InChIKey | NCKOCQLSTXIAJL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|