C17H17Cl2NOS — CID 99999188
N-[3-(2-chlorophenyl)propyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 99999188) has the molecular formula C17H17Cl2NOS and a molecular weight of 354.30 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 99999188 |
| Molecular Formula | C17H17Cl2NOS |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NCCCc1ccccc1Cl |
| InChI | InChI=1S/C17H17Cl2NOS/c18-14-7-9-15(10-8-14)22-12-17(21)20-11-3-5-13-4-1-2-6-16(13)19/h1-2,4,6-10H,3,5,11-12H2,(H,20,21) |
| InChIKey | VXXIUICTQWARNC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|