C20H17ClN2OS — CID 5245438
2-(4-chlorophenyl)sulfanyl-N',N'-diphenylacetohydrazide (PubChem CID 5245438) has the molecular formula C20H17ClN2OS and a molecular weight of 368.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N',N'-diphenylacetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 5245438 |
| Molecular Formula | C20H17ClN2OS |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N',N'-diphenylacetohydrazide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN2OS/c21-16-11-13-19(14-12-16)25-15-20(24)22-23(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H,15H2,(H,22,24) |
| InChIKey | KGUQAVWLKDGEKG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|