C17H16N4OS2 — CID 3995958
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N',N'-diphenylacetohydrazide (PubChem CID 3995958) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N',N'-diphenylacetohydrazide.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 3995958 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N',N'-diphenylacetohydrazide |
| SMILES | Cc1nnc(SCC(=O)NN(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C17H16N4OS2/c1-13-18-19-17(24-13)23-12-16(22)20-21(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11H,12H2,1H3,(H,20,22) |
| InChIKey | RATJAWFDIOQVDQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|