C12H12N4O2S2 — CID 672788
N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 672788) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 672788 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1nnc(SCC(=O)NNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C12H12N4O2S2/c1-8-13-16-12(20-8)19-7-10(17)14-15-11(18)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | KNVBXDSBGRVLJW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|