C13H13ClN4O3S2 — CID 2567469
2-(4-chlorophenoxy)-N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]acetohydrazide (PubChem CID 2567469) has the molecular formula C13H13ClN4O3S2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]acetohydrazide.
| Compound Name | 2-(4-chlorophenoxy)-N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 2567469 |
| Molecular Formula | C13H13ClN4O3S2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-(4-chlorophenoxy)-N'-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]acetohydrazide |
| SMILES | Cc1nnc(SCC(=O)NNC(=O)COc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H13ClN4O3S2/c1-8-15-18-13(23-8)22-7-12(20)17-16-11(19)6-21-10-4-2-9(14)3-5-10/h2-5H,6-7H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | BXUVYJDFDBLUGG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|