C20H18ClN5O4S2 — CID 40833612
N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-chlorophenoxy)acetamide (PubChem CID 40833612) has the molecular formula C20H18ClN5O4S2 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 40833612 |
| Molecular Formula | C20H18ClN5O4S2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-chlorophenoxy)acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2nnc(NC(=O)COc3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C20H18ClN5O4S2/c1-12(27)22-14-3-2-4-15(9-14)23-18(29)11-31-20-26-25-19(32-20)24-17(28)10-30-16-7-5-13(21)6-8-16/h2-9H,10-11H2,1H3,(H,22,27)(H,23,29)(H,24,25,28) |
| InChIKey | DSXHIJJEWIVYTF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|