C20H18Cl2N4O4S2 — CID 23908479
2-(2,4-dichlorophenoxy)-N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 23908479) has the molecular formula C20H18Cl2N4O4S2 and a molecular weight of 513.43 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23908479 |
| Molecular Formula | C20H18Cl2N4O4S2 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(NC(=O)COc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C20H18Cl2N4O4S2/c1-2-29-14-6-4-13(5-7-14)23-18(28)11-31-20-26-25-19(32-20)24-17(27)10-30-16-8-3-12(21)9-15(16)22/h3-9H,2,10-11H2,1H3,(H,23,28)(H,24,25,27) |
| InChIKey | FRDLZMAAWCAMQL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|