C18H18N4O3S3 — CID 23995581
N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 23995581) has the molecular formula C18H18N4O3S3 and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 23995581 |
| Molecular Formula | C18H18N4O3S3 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(NC(=O)Cc3cccs3)s2)cc1 |
| InChI | InChI=1S/C18H18N4O3S3/c1-2-25-13-7-5-12(6-8-13)19-16(24)11-27-18-22-21-17(28-18)20-15(23)10-14-4-3-9-26-14/h3-9H,2,10-11H2,1H3,(H,19,24)(H,20,21,23) |
| InChIKey | RAUXQXIDZDZBLZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|