C20H17N5O3S3 — CID 121029797
N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide (PubChem CID 121029797) has the molecular formula C20H17N5O3S3 and a molecular weight of 471.59 g/mol. Its IUPAC name is N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 121029797 |
| Molecular Formula | C20H17N5O3S3 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(NC(=O)c3nc4ccccc4s3)s2)cc1 |
| InChI | InChI=1S/C20H17N5O3S3/c1-2-28-13-9-7-12(8-10-13)21-16(26)11-29-20-25-24-19(31-20)23-17(27)18-22-14-5-3-4-6-15(14)30-18/h3-10H,2,11H2,1H3,(H,21,26)(H,23,24,27) |
| InChIKey | UAIZJVMCJDZBFO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|