C23H26N4O3S2 — CID 44956537
N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-ethoxybenzamide (PubChem CID 44956537) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-ethoxybenzamide.
| Compound Name | N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 44956537 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-ethoxybenzamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccc(OCC)cc3)s2)cc1 |
| InChI | InChI=1S/C23H26N4O3S2/c1-3-5-6-16-7-11-18(12-8-16)24-20(28)15-31-23-27-26-22(32-23)25-21(29)17-9-13-19(14-10-17)30-4-2/h7-14H,3-6,15H2,1-2H3,(H,24,28)(H,25,26,29) |
| InChIKey | PLNBXXKLJSUPKG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|