C27H26N4O2S2 — CID 44956663
N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-phenylbenzamide (PubChem CID 44956663) has the molecular formula C27H26N4O2S2 and a molecular weight of 502.67 g/mol. Its IUPAC name is N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-phenylbenzamide.
| Compound Name | N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 44956663 |
| Molecular Formula | C27H26N4O2S2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-phenylbenzamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccc(-c4ccccc4)cc3)s2)cc1 |
| InChI | InChI=1S/C27H26N4O2S2/c1-2-3-7-19-10-16-23(17-11-19)28-24(32)18-34-27-31-30-26(35-27)29-25(33)22-14-12-21(13-15-22)20-8-5-4-6-9-20/h4-6,8-17H,2-3,7,18H2,1H3,(H,28,32)(H,29,30,33) |
| InChIKey | LQEIXWVPMWUTDP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|