C23H26N4O2S3 — CID 44956963
2-benzylsulfanyl-N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 44956963) has the molecular formula C23H26N4O2S3 and a molecular weight of 486.69 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 44956963 |
| Molecular Formula | C23H26N4O2S3 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-benzylsulfanyl-N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2nnc(NC(=O)CSCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C23H26N4O2S3/c1-2-3-7-17-10-12-19(13-11-17)24-21(29)16-31-23-27-26-22(32-23)25-20(28)15-30-14-18-8-5-4-6-9-18/h4-6,8-13H,2-3,7,14-16H2,1H3,(H,24,29)(H,25,26,28) |
| InChIKey | BBEFRZXTQKZZEC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|