C19H17FN4O2S3 — CID 40827744
2-benzylsulfanyl-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 40827744) has the molecular formula C19H17FN4O2S3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 40827744 |
| Molecular Formula | C19H17FN4O2S3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-benzylsulfanyl-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(NC(=O)CSCc2ccccc2)s1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O2S3/c20-14-6-8-15(9-7-14)21-17(26)12-28-19-24-23-18(29-19)22-16(25)11-27-10-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,21,26)(H,22,23,25) |
| InChIKey | WMWNICNVZOZFNT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|